Products 1547588-59-9

CAS 1547588-59-9 is the registry number for 4-(Ethylsulfanyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-ethylsulfanylcyclohexane-1-carboxylic acid (CAS 1547588-59-9) is a chemical compound with the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. IUPAC name: 4-ethylsulfanylcyclohexane-1-carboxylic acid. InChIKey: FQQYRTYZYYKJNU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O2S
Molecular weight188.29 g/mol
IUPAC name4-ethylsulfanylcyclohexane-1-carboxylic acid
InChIKeyFQQYRTYZYYKJNU-UHFFFAOYSA-N
SMILESCCSC1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)