CAS 1547764-90-8 is the registry number for tert-Butyl (2-chloro-4,6-difluorophenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(2-chloro-4,6-difluorophenyl)carbamate (CAS 1547764-90-8) is a chemical compound with the molecular formula C11H12ClF2NO2 and a molecular weight of 263.67 g/mol. IUPAC name: tert-butyl N-(2-chloro-4,6-difluorophenyl)carbamate. InChIKey: NURBHVGYJCBOSZ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF2NO2 |
|---|---|
| Molecular weight | 263.67 g/mol |
| IUPAC name | tert-butyl N-(2-chloro-4,6-difluorophenyl)carbamate |
| InChIKey | NURBHVGYJCBOSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1Cl)F)F |
Computed by PubChem (NCBI)