Products 1547967-32-7

CAS 1547967-32-7 is the registry number for Ethyl 5-(chlorosulfonyl)-1-benzothiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 5-chlorosulfonyl-1-benzothiophene-2-carboxylate (CAS 1547967-32-7) is a chemical compound with the molecular formula C11H9ClO4S2 and a molecular weight of 304.8 g/mol. IUPAC name: ethyl 5-chlorosulfonyl-1-benzothiophene-2-carboxylate. InChIKey: BVDNJDOKZQXNEB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClO4S2
Molecular weight304.8 g/mol
IUPAC nameethyl 5-chlorosulfonyl-1-benzothiophene-2-carboxylate
InChIKeyBVDNJDOKZQXNEB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(S1)C=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)