CAS 1547967-32-7 is the registry number for Ethyl 5-(chlorosulfonyl)-1-benzothiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 5-chlorosulfonyl-1-benzothiophene-2-carboxylate (CAS 1547967-32-7) is a chemical compound with the molecular formula C11H9ClO4S2 and a molecular weight of 304.8 g/mol. IUPAC name: ethyl 5-chlorosulfonyl-1-benzothiophene-2-carboxylate. InChIKey: BVDNJDOKZQXNEB-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO4S2 |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | ethyl 5-chlorosulfonyl-1-benzothiophene-2-carboxylate |
| InChIKey | BVDNJDOKZQXNEB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)