CAS 1548-84-1 appears in our catalog under these names: Benzoic acid pentafluorophenyl ester, 95%, Perfluorophenyl benzoate, 98%, Perfluorophenyl benzoate, Pentafluorophenyl Benzoate, >98.0%(GC), Perfluorophenyl benzoate, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g.
(2,3,4,5,6-pentafluorophenyl) benzoate (CAS 1548-84-1) is a chemical compound with the molecular formula C13H5F5O2 and a molecular weight of 288.17 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) benzoate. InChIKey: WZPWTXZSQHIABL-UHFFFAOYSA-N.
| Molecular formula | C13H5F5O2 |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) benzoate |
| InChIKey | WZPWTXZSQHIABL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)