CAS 1548085-92-2 is the registry number for 2-(2-(1,1-Dioxidotetrahydrothiophen-3-yl)thiazol-4-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[2-(1,1-dioxothiolan-3-yl)-1,3-thiazol-4-yl]acetic acid (CAS 1548085-92-2) is a chemical compound with the molecular formula C9H11NO4S2 and a molecular weight of 261.3 g/mol. IUPAC name: 2-[2-(1,1-dioxothiolan-3-yl)-1,3-thiazol-4-yl]acetic acid. InChIKey: MRFONOUDCDVXKN-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S2 |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 2-[2-(1,1-dioxothiolan-3-yl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | MRFONOUDCDVXKN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)