Products 1548116-54-6

CAS 1548116-54-6 is the registry number for SN34037, 99.02%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 10 mg.

Structural formula: {0} (CAS {1})

[4-(2,4-dichlorophenyl)piperazin-1-yl]-morpholin-4-ylmethanone (CAS 1548116-54-6) is a chemical compound with the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.2 g/mol. IUPAC name: [4-(2,4-dichlorophenyl)piperazin-1-yl]-morpholin-4-ylmethanone. InChIKey: ZVSJDUNUGMVNIL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19Cl2N3O2
Molecular weight344.2 g/mol
IUPAC name[4-(2,4-dichlorophenyl)piperazin-1-yl]-morpholin-4-ylmethanone
InChIKeyZVSJDUNUGMVNIL-UHFFFAOYSA-N
SMILESC1CN(CCN1C2=C(C=C(C=C2)Cl)Cl)C(=O)N3CCOCC3

Computed by PubChem (NCBI)