CAS 154819-83-7 is the registry number for (1R,2S,4S)-Rel-7-benzyl-7-azabicyclo[2.2.1]heptan-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
(1R,2S,4S)-7-benzyl-7-azabicyclo[2.2.1]heptan-2-ol (CAS 154819-83-7) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: (1R,2S,4S)-7-benzyl-7-azabicyclo[2.2.1]heptan-2-ol. InChIKey: VRJOXKWODDCDBE-XQQFMLRXSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | (1R,2S,4S)-7-benzyl-7-azabicyclo[2.2.1]heptan-2-ol |
| InChIKey | VRJOXKWODDCDBE-XQQFMLRXSA-N |
| SMILES | C1C[C@@H]2[C@H](C[C@H]1N2CC3=CC=CC=C3)O |
Computed by PubChem (NCBI)