CAS 1548193-78-7 appears in our catalog under these names: 4-(5-Bromo-2-fluorophenyl)-2,6-dichloropyrimidine, 95%, 4-(5-Bromo-2-fluorophenyl)-2,6-dichloropyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(5-bromo-2-fluorophenyl)-2,6-dichloropyrimidine (CAS 1548193-78-7) is a chemical compound with the molecular formula C10H4BrCl2FN2 and a molecular weight of 321.96 g/mol. IUPAC name: 4-(5-bromo-2-fluorophenyl)-2,6-dichloropyrimidine. InChIKey: XREUWWFYPBYSHD-UHFFFAOYSA-N.
| Molecular formula | C10H4BrCl2FN2 |
|---|---|
| Molecular weight | 321.96 g/mol |
| IUPAC name | 4-(5-bromo-2-fluorophenyl)-2,6-dichloropyrimidine |
| InChIKey | XREUWWFYPBYSHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C2=CC(=NC(=N2)Cl)Cl)F |
Computed by PubChem (NCBI)