CAS 154830-98-5 appears in our catalog under these names: (2S)-2-Amino-N,N,3,3-tetramethylbutanamide hydrochloride, 95%, (2S)-2-Amino-N,N,3,3-tetramethylbutanamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2S)-2-amino-N,N,3,3-tetramethylbutanamide;hydrochloride (CAS 154830-98-5) is a chemical compound with the molecular formula C8H19ClN2O and a molecular weight of 194.70 g/mol. IUPAC name: (2S)-2-amino-N,N,3,3-tetramethylbutanamide;hydrochloride. InChIKey: ZZAKIBYILBSOIQ-FYZOBXCZSA-N.
| Molecular formula | C8H19ClN2O |
|---|---|
| Molecular weight | 194.70 g/mol |
| IUPAC name | (2S)-2-amino-N,N,3,3-tetramethylbutanamide;hydrochloride |
| InChIKey | ZZAKIBYILBSOIQ-FYZOBXCZSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N(C)C)N.Cl |
Computed by PubChem (NCBI)