Products 1548423-60-4
CAS 1548423-60-4 is the registry number for 6-Bromo-2-(2,6-difluorophenyl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-(2,6-difluorophenyl)imidazo[1,2-a]pyridine (CAS 1548423-60-4) is a chemical compound with the molecular formula C13H7BrF2N2 and a molecular weight of 309.11 g/mol. IUPAC name: 6-bromo-2-(2,6-difluorophenyl)imidazo[1,2-a]pyridine. InChIKey: ABHXSFBVBPOXDA-UHFFFAOYSA-N.
| Molecular formula | C13H7BrF2N2 |
|---|---|
| Molecular weight | 309.11 g/mol |
| IUPAC name | 6-bromo-2-(2,6-difluorophenyl)imidazo[1,2-a]pyridine |
| InChIKey | ABHXSFBVBPOXDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=CN3C=C(C=CC3=N2)Br)F |
Computed by PubChem (NCBI)