CAS 154879-59-1 is the registry number for rac-Fenoxaprop P-Ethyl-2-ethylformate. Offered by: TRC. Available pack sizes: 2,5g.
Diethyl 2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]-2-methylpropanedioate (CAS 154879-59-1) is a chemical compound with the molecular formula C21H20ClNO7 and a molecular weight of 433.8 g/mol. IUPAC name: diethyl 2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]-2-methylpropanedioate. InChIKey: STHXFMVMUCMJMV-UHFFFAOYSA-N.
| Molecular formula | C21H20ClNO7 |
|---|---|
| Molecular weight | 433.8 g/mol |
| IUPAC name | diethyl 2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]-2-methylpropanedioate |
| InChIKey | STHXFMVMUCMJMV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)