CAS 1548833-31-3 appears in our catalog under these names: potassium 1h-1,2,3,4-tetrazole-5-carboxylate, 95%, Potassium 1H-1,2,3,4-tetrazole-5-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 1g, 10g.
Potassium 2H-tetrazole-5-carboxylate (CAS 1548833-31-3) is a chemical compound with the molecular formula C2HKN4O2 and a molecular weight of 152.15 g/mol. IUPAC name: potassium 2H-tetrazole-5-carboxylate. InChIKey: GJLQCXFNBJXQDP-UHFFFAOYSA-M.
| Molecular formula | C2HKN4O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | potassium 2H-tetrazole-5-carboxylate |
| InChIKey | GJLQCXFNBJXQDP-UHFFFAOYSA-M |
| SMILES | C1(=NNN=N1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)