CAS 154934-68-6 is the registry number for SP100030 analogue 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-N-[3-fluoro-5-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide (CAS 154934-68-6) is a chemical compound with the molecular formula C13H5ClF7N3O and a molecular weight of 387.64 g/mol. IUPAC name: 2-chloro-N-[3-fluoro-5-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide. InChIKey: UAESMOLVKWXOPC-UHFFFAOYSA-N.
| Molecular formula | C13H5ClF7N3O |
|---|---|
| Molecular weight | 387.64 g/mol |
| IUPAC name | 2-chloro-N-[3-fluoro-5-(trifluoromethyl)phenyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| InChIKey | UAESMOLVKWXOPC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1NC(=O)C2=CN=C(N=C2C(F)(F)F)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)