Products 1549916-08-6
CAS 1549916-08-6 is the registry number for Methyl 3-(difluoromethyl)-(1,2,4)triazolo(4,3-a)pyridine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3-(difluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate (CAS 1549916-08-6) is a chemical compound with the molecular formula C9H7F2N3O2 and a molecular weight of 227.17 g/mol. IUPAC name: methyl 3-(difluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate. InChIKey: ZKBVKHMXSCBUSP-UHFFFAOYSA-N.
| Molecular formula | C9H7F2N3O2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | methyl 3-(difluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
| InChIKey | ZKBVKHMXSCBUSP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=NN=C2C(F)F)C=C1 |
Computed by PubChem (NCBI)