CAS 1550053-02-5 appears in our catalog under these names: BRD3308, Brd3308, 95%, BRD3308/ 97.12% (existing batch purity), BRD 3308, BRD3308 98%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 250mg, 100mg, 1g, 2mg, 10mg, 25mg, 50mg.
4-acetamido-N-(2-amino-4-fluorophenyl)benzamide (CAS 1550053-02-5) is a chemical compound with the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. IUPAC name: 4-acetamido-N-(2-amino-4-fluorophenyl)benzamide. InChIKey: RRJDFENBXIEAPD-UHFFFAOYSA-N.
| Molecular formula | C15H14FN3O2 |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | 4-acetamido-N-(2-amino-4-fluorophenyl)benzamide |
| InChIKey | RRJDFENBXIEAPD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)F)N |
Computed by PubChem (NCBI)