Products 1550485-50-1

CAS 1550485-50-1 is the registry number for tert-Butyl 3-aminopentanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-aminopentanoate (CAS 1550485-50-1) is a chemical compound with the molecular formula C9H19NO2 and a molecular weight of 173.25 g/mol. IUPAC name: tert-butyl 3-aminopentanoate. InChIKey: KLZKLOMEOUQHEO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19NO2
Molecular weight173.25 g/mol
IUPAC nametert-butyl 3-aminopentanoate
InChIKeyKLZKLOMEOUQHEO-UHFFFAOYSA-N
SMILESCCC(CC(=O)OC(C)(C)C)N

Computed by PubChem (NCBI)