CAS 1550576-58-3 is the registry number for (3-(Difluoromethyl)phenyl)methanesulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[3-(difluoromethyl)phenyl]methanesulfonamide (CAS 1550576-58-3) is a chemical compound with the molecular formula C8H9F2NO2S and a molecular weight of 221.23 g/mol. IUPAC name: [3-(difluoromethyl)phenyl]methanesulfonamide. InChIKey: XUAQAADRAVNTTM-UHFFFAOYSA-N.
| Molecular formula | C8H9F2NO2S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | [3-(difluoromethyl)phenyl]methanesulfonamide |
| InChIKey | XUAQAADRAVNTTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)F)CS(=O)(=O)N |
Computed by PubChem (NCBI)