CAS 155059-42-0 appears in our catalog under these names: SM-21 maleate, SM–21 maleate, Sm21 maleate, SM-21 (maleate). Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 50mg, 100mg, 10 mg, 5 mg.
(Z)-but-2-enedioic acid;[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chlorophenoxy)butanoate (CAS 155059-42-0) is a chemical compound with the molecular formula C22H28ClNO7 and a molecular weight of 453.9 g/mol. IUPAC name: (Z)-but-2-enedioic acid;[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chlorophenoxy)butanoate. InChIKey: BHXGTFUQDGMXHA-ASIQKIFFSA-N.
| Molecular formula | C22H28ClNO7 |
|---|---|
| Molecular weight | 453.9 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chlorophenoxy)butanoate |
| InChIKey | BHXGTFUQDGMXHA-ASIQKIFFSA-N |
| SMILES | CCC(C(=O)OC1C[C@H]2CC[C@@H](C1)N2C)OC3=CC=C(C=C3)Cl.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)