CAS 1550671-45-8 appears in our catalog under these names: tert-Butyl 2-amino-4-(thiophen-2-yl)thiophene-3-carboxylate, 95%, tert-Butyl 5'-amino-(2,3'-bithiophene)-4'-carboxylate, 98%, tert-Butyl 2-amino-4-(thiophen-2-yl)thiophene-3-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Tert-butyl 2-amino-4-thiophen-2-ylthiophene-3-carboxylate (CAS 1550671-45-8) is a chemical compound with the molecular formula C13H15NO2S2 and a molecular weight of 281.4 g/mol. IUPAC name: tert-butyl 2-amino-4-thiophen-2-ylthiophene-3-carboxylate. InChIKey: VYVZSAFFXIVBAC-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2S2 |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | tert-butyl 2-amino-4-thiophen-2-ylthiophene-3-carboxylate |
| InChIKey | VYVZSAFFXIVBAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(SC=C1C2=CC=CS2)N |
Computed by PubChem (NCBI)