Products 155073-46-4
CAS 155073-46-4 appears in our catalog under these names: (±)16(17)–EpDPA, (±)16(17)–EpDPA MaxSpec® Standard, (±)16(17)-EpDPA, 99.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 25μg, 50μg, 500μg, 100 μg (290.28 μM * 1 mL in Ethanol).
(4Z,7Z,10Z,13Z)-15-[(2S,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]pentadeca-4,7,10,13-tetraenoic acid (CAS 155073-46-4) is a chemical compound with the molecular formula C22H32O3 and a molecular weight of 344.5 g/mol. IUPAC name: (4Z,7Z,10Z,13Z)-15-[(2S,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]pentadeca-4,7,10,13-tetraenoic acid. InChIKey: BCTXZWCPBLWCRV-QCAYAECISA-N.
| Molecular formula | C22H32O3 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | (4Z,7Z,10Z,13Z)-15-[(2S,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]pentadeca-4,7,10,13-tetraenoic acid |
| InChIKey | BCTXZWCPBLWCRV-QCAYAECISA-N |
| SMILES | CC/C=C\C[C@@H]1[C@@H](O1)C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O |
Computed by PubChem (NCBI)