CAS 15509-33-8 appears in our catalog under these names: Policresulen Impurity A, Policresulen Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-hydroxy-6-methylbenzene-1,3-disulfonic acid (CAS 15509-33-8) is a chemical compound with the molecular formula C7H8O7S2 and a molecular weight of 268.3 g/mol. IUPAC name: 4-hydroxy-6-methylbenzene-1,3-disulfonic acid. InChIKey: VXBOGQDATFKUAM-UHFFFAOYSA-N.
| Molecular formula | C7H8O7S2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 4-hydroxy-6-methylbenzene-1,3-disulfonic acid |
| InChIKey | VXBOGQDATFKUAM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)