CAS 1551231-60-7 is the registry number for 2,3-Dimethyl-2-(4-(trifluoromethyl)benzyl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid (CAS 1551231-60-7) is a chemical compound with the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. IUPAC name: 2,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid. InChIKey: OCKDJOWGWBTCDO-UHFFFAOYSA-N.
| Molecular formula | C14H17F3O2 |
|---|---|
| Molecular weight | 274.28 g/mol |
| IUPAC name | 2,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid |
| InChIKey | OCKDJOWGWBTCDO-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(CC1=CC=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)