Products 1551231-60-7

CAS 1551231-60-7 is the registry number for 2,3-Dimethyl-2-(4-(trifluoromethyl)benzyl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid (CAS 1551231-60-7) is a chemical compound with the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. IUPAC name: 2,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid. InChIKey: OCKDJOWGWBTCDO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17F3O2
Molecular weight274.28 g/mol
IUPAC name2,3-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]butanoic acid
InChIKeyOCKDJOWGWBTCDO-UHFFFAOYSA-N
SMILESCC(C)C(C)(CC1=CC=C(C=C1)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)