Products 1551297-38-1

CAS 1551297-38-1 is the registry number for 2-(2-Methoxybenzyl)-2,3-dimethylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-methoxyphenyl)methyl]-2,3-dimethylbutanoic acid (CAS 1551297-38-1) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: 2-[(2-methoxyphenyl)methyl]-2,3-dimethylbutanoic acid. InChIKey: GGJIZRDUTHKXBL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O3
Molecular weight236.31 g/mol
IUPAC name2-[(2-methoxyphenyl)methyl]-2,3-dimethylbutanoic acid
InChIKeyGGJIZRDUTHKXBL-UHFFFAOYSA-N
SMILESCC(C)C(C)(CC1=CC=CC=C1OC)C(=O)O

Computed by PubChem (NCBI)