CAS 155130-15-7 appears in our catalog under these names: Peg6-tos, 97%, PEG5–Tos, PEG5-Tos 98%, 3,6,9,12-Tetraoxatetradecane-1,14-diol, 1-4-methylbenzenesulfonate, 98%, 98%, PEG5-Tos, 99.35%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 10mg, 100mg, 10mM (in 1ml dmso), 50mg, 250mg, 250 mg.
2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 155130-15-7) is a chemical compound with the molecular formula C17H28O8S and a molecular weight of 392.5 g/mol. IUPAC name: 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: NSODVVYOWINKAG-UHFFFAOYSA-N.
| Molecular formula | C17H28O8S |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | NSODVVYOWINKAG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)