CAS 1551566-32-5 is the registry number for 4-(4-Bromo-2-chlorophenyl)-2,6-dichloropyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(4-bromo-2-chlorophenyl)-2,6-dichloropyrimidine (CAS 1551566-32-5) is a chemical compound with the molecular formula C10H4BrCl3N2 and a molecular weight of 338.4 g/mol. IUPAC name: 4-(4-bromo-2-chlorophenyl)-2,6-dichloropyrimidine. InChIKey: LGXLUWNKIMWYGZ-UHFFFAOYSA-N.
| Molecular formula | C10H4BrCl3N2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 4-(4-bromo-2-chlorophenyl)-2,6-dichloropyrimidine |
| InChIKey | LGXLUWNKIMWYGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)