CAS 155185-01-6 is the registry number for (R)-1-Azido-4-(methylsulfinyl)-butane, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
1-azido-4-[(R)-methylsulfinyl]butane (CAS 155185-01-6) is a chemical compound with the molecular formula C5H11N3OS and a molecular weight of 161.23 g/mol. IUPAC name: 1-azido-4-[(R)-methylsulfinyl]butane. InChIKey: SCBWZMZIFFMINE-SNVBAGLBSA-N.
| Molecular formula | C5H11N3OS |
|---|---|
| Molecular weight | 161.23 g/mol |
| IUPAC name | 1-azido-4-[(R)-methylsulfinyl]butane |
| InChIKey | SCBWZMZIFFMINE-SNVBAGLBSA-N |
| SMILES | C[S@@](=O)CCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)