CAS 155196-97-7 appears in our catalog under these names: 1-(2-Azidoethoxy)-alpha-D-mannopyranose, 95%, alpha-Man-N3, 2-Azidoethyl α-D-mannopyranoside, 2'-Azidoethyl a-mannopyranoside, 2'-Azidoethyl a-mannopyranoside 95%. Offered by: Combi-blocks, Iris Biotech, Chemat, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 500mg, 50mg, 1000mg.
(2S,3S,4S,5S,6R)-2-(2-azidoethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 155196-97-7) is a chemical compound with the molecular formula C8H15N3O6 and a molecular weight of 249.22 g/mol. IUPAC name: (2S,3S,4S,5S,6R)-2-(2-azidoethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: VGCOVRUENPCVTD-HEIBUPTGSA-N.
| Molecular formula | C8H15N3O6 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | (2S,3S,4S,5S,6R)-2-(2-azidoethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | VGCOVRUENPCVTD-HEIBUPTGSA-N |
| SMILES | C(CO[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)