CAS 155206-01-2 appears in our catalog under these names: Bimatoprost Impurity E, Bimatoprost Impurity 5, 17- Phenyl Trinor Prostaglandin F2alpha Methyl Amide (>90%), 17-Phenyl trinor prostaglandin F2α methyl amide, 97%, 17-phenyl trinor Prostaglandin F2α methyl amide. Offered by: Chemat Brand, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 1mg, 5mg, 50mg, 1 mg.
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylhept-5-enamide (CAS 155206-01-2) is a chemical compound with the molecular formula C24H35NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylhept-5-enamide. InChIKey: UWIWNJFBNIMMGY-FDBOBMRISA-N.
| Molecular formula | C24H35NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-N-methylhept-5-enamide |
| InChIKey | UWIWNJFBNIMMGY-FDBOBMRISA-N |
| SMILES | CNC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@H](CCC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)