CAS 1552063-07-6 is the registry number for Ethyl 2-(2-fluoro-3-(trifluoromethyl)phenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[2-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylate (CAS 1552063-07-6) is a chemical compound with the molecular formula C13H9F4NO2S and a molecular weight of 319.28 g/mol. IUPAC name: ethyl 2-[2-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylate. InChIKey: LAHNMYINISCLSG-UHFFFAOYSA-N.
| Molecular formula | C13H9F4NO2S |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | ethyl 2-[2-fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxylate |
| InChIKey | LAHNMYINISCLSG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=C(C(=CC=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)