Products 1552617-61-4
CAS 1552617-61-4 is the registry number for 4-Amino-N',N',1-trimethyl-1H-pyrazole-3-carbohydrazide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-N',N',1-trimethylpyrazole-3-carbohydrazide (CAS 1552617-61-4) is a chemical compound with the molecular formula C7H13N5O and a molecular weight of 183.21 g/mol. IUPAC name: 4-amino-N',N',1-trimethylpyrazole-3-carbohydrazide. InChIKey: FDBFYDNOHTXXEJ-UHFFFAOYSA-N.
| Molecular formula | C7H13N5O |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 4-amino-N',N',1-trimethylpyrazole-3-carbohydrazide |
| InChIKey | FDBFYDNOHTXXEJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)NN(C)C)N |
Computed by PubChem (NCBI)