Products 1552918-79-2
CAS 1552918-79-2 is the registry number for 6-Chloro-N-(2,2-difluoroethyl)-2-methylpyrimidin-4-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-N-(2,2-difluoroethyl)-2-methylpyrimidin-4-amine (CAS 1552918-79-2) is a chemical compound with the molecular formula C7H8ClF2N3 and a molecular weight of 207.61 g/mol. IUPAC name: 6-chloro-N-(2,2-difluoroethyl)-2-methylpyrimidin-4-amine. InChIKey: GJSWVZJNSNWUGE-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF2N3 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 6-chloro-N-(2,2-difluoroethyl)-2-methylpyrimidin-4-amine |
| InChIKey | GJSWVZJNSNWUGE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)NCC(F)F |
Computed by PubChem (NCBI)