CAS 15534-74-4 appears in our catalog under these names: Policresulen Impurity 1, Policresulen Impurity 13, 4,4'-Methylenebis(3-methyl-phenol), 4,4-Methylenebis(3-methyl-phenol). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(4-hydroxy-2-methylphenyl)methyl]-3-methylphenol (CAS 15534-74-4) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: 4-[(4-hydroxy-2-methylphenyl)methyl]-3-methylphenol. InChIKey: WKNMHADBVOPGEF-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 4-[(4-hydroxy-2-methylphenyl)methyl]-3-methylphenol |
| InChIKey | WKNMHADBVOPGEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)O)CC2=C(C=C(C=C2)O)C |
Computed by PubChem (NCBI)