Products 1553562-87-0
CAS 1553562-87-0 appears in our catalog under these names: 2-methyl-1-(2,2,2-trifluoroethyl)-1H-1,3-benzodiazole-4-carboxylic acid, 95%, 2-Methyl-1-(2,2,2-trifluoroethyl)-1H-benzo(d)imidazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxylic acid (CAS 1553562-87-0) is a chemical compound with the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. IUPAC name: 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxylic acid. InChIKey: HUOCFIFXMLOJMX-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O2 |
|---|---|
| Molecular weight | 258.20 g/mol |
| IUPAC name | 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-4-carboxylic acid |
| InChIKey | HUOCFIFXMLOJMX-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2N1CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)