CAS 1553616-30-0 is the registry number for 3-Bromo-4-(2,2-difluoroethoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-4-(2,2-difluoroethoxy)aniline (CAS 1553616-30-0) is a chemical compound with the molecular formula C8H8BrF2NO and a molecular weight of 252.06 g/mol. IUPAC name: 3-bromo-4-(2,2-difluoroethoxy)aniline. InChIKey: FEQANXCISQSMKM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrF2NO |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 3-bromo-4-(2,2-difluoroethoxy)aniline |
| InChIKey | FEQANXCISQSMKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Br)OCC(F)F |
Computed by PubChem (NCBI)