CAS 1553977-79-9 is the registry number for Piperidin-3-ol-d9. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2,3,4,4,5,5,6,6-nonadeuteriopiperidin-3-ol (CAS 1553977-79-9) is a chemical compound with the molecular formula C5H11NO and a molecular weight of 110.20 g/mol. IUPAC name: 2,2,3,4,4,5,5,6,6-nonadeuteriopiperidin-3-ol. InChIKey: BIWOSRSKDCZIFM-UHUJFCCWSA-N.
| Molecular formula | C5H11NO |
|---|---|
| Molecular weight | 110.20 g/mol |
| IUPAC name | 2,2,3,4,4,5,5,6,6-nonadeuteriopiperidin-3-ol |
| InChIKey | BIWOSRSKDCZIFM-UHUJFCCWSA-N |
| SMILES | [2H]C1(C(C(C(NC1([2H])[2H])([2H])[2H])([2H])O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)