CAS 1554-60-5 appears in our catalog under these names: Fluphenazine Decanoate Impurity 16, 1-(2-(Trifluoromethyl)-10H-phenothiazin-10-yl)ethanone. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone (CAS 1554-60-5) is a chemical compound with the molecular formula C15H10F3NOS and a molecular weight of 309.31 g/mol. IUPAC name: 1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone. InChIKey: WXGZFYXVFYBWRP-UHFFFAOYSA-N.
| Molecular formula | C15H10F3NOS |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | 1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
| InChIKey | WXGZFYXVFYBWRP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC=CC=C2SC3=C1C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)