CAS 1554171-73-1 is the registry number for 4-[(1,1-Dimethylethyl)thio]-3-(trifluoromethyl)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-tert-butylsulfanyl-3-(trifluoromethyl)benzaldehyde (CAS 1554171-73-1) is a chemical compound with the molecular formula C12H13F3OS and a molecular weight of 262.29 g/mol. IUPAC name: 4-tert-butylsulfanyl-3-(trifluoromethyl)benzaldehyde. InChIKey: SHLTWNVRAHCONH-UHFFFAOYSA-N.
| Molecular formula | C12H13F3OS |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 4-tert-butylsulfanyl-3-(trifluoromethyl)benzaldehyde |
| InChIKey | SHLTWNVRAHCONH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)SC1=C(C=C(C=C1)C=O)C(F)(F)F |
Computed by PubChem (NCBI)