Products 155488-34-9
CAS 155488-34-9 is the registry number for 1,9-Caryolanediol 9-acetate. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
[(1R,2S,5R,8S,9S)-1-hydroxy-4,4,8-trimethyl-9-tricyclo[6.3.1.02,5]dodecanyl] acetate (CAS 155488-34-9) is a chemical compound with the molecular formula C17H28O3 and a molecular weight of 280.4 g/mol. IUPAC name: [(1R,2S,5R,8S,9S)-1-hydroxy-4,4,8-trimethyl-9-tricyclo[6.3.1.02,5]dodecanyl] acetate. InChIKey: LRFYCTLMXJJJHZ-UAHISNFZSA-N.
| Molecular formula | C17H28O3 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | [(1R,2S,5R,8S,9S)-1-hydroxy-4,4,8-trimethyl-9-tricyclo[6.3.1.02,5]dodecanyl] acetate |
| InChIKey | LRFYCTLMXJJJHZ-UAHISNFZSA-N |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C[C@@]1(CC[C@@H]3[C@@H]2CC3(C)C)C)O |
Computed by PubChem (NCBI)
Synonyms:
1,9-Caryolanediol 9-acetate, orb1681394