CAS 15553-50-1 appears in our catalog under these names: Tetrahexylammonium tetrafluoroborate, 95%, TETRAHEXYLAMMONIUM TETRAFLUOROBORATE, >&, Tetrahexylammonium tetrafluoroborate, 97%+,RG, 97%+,RG. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 1g, 5g.
Tetrahexylazanium tetrafluoroborate (CAS 15553-50-1) is a chemical compound with the molecular formula C24H52BF4N and a molecular weight of 441.5 g/mol. IUPAC name: tetrahexylazanium tetrafluoroborate. InChIKey: QNJIMRNKXMJLJQ-UHFFFAOYSA-N.
| Molecular formula | C24H52BF4N |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | tetrahexylazanium tetrafluoroborate |
| InChIKey | QNJIMRNKXMJLJQ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
Computed by PubChem (NCBI)