Products 1555335-57-3
CAS 1555335-57-3 is the registry number for (1,2,3)Triazolo(1,5-a)pyridine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Triazolo[1,5-a]pyridine-7-carboxylic acid (CAS 1555335-57-3) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: triazolo[1,5-a]pyridine-7-carboxylic acid. InChIKey: QVEYWLQAIBRGPE-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | triazolo[1,5-a]pyridine-7-carboxylic acid |
| InChIKey | QVEYWLQAIBRGPE-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=NN2C(=C1)C(=O)O |
Computed by PubChem (NCBI)