CAS 155559-80-1 is the registry number for 5-(Ethylsulfonyl)-1,3-benzoxazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-ethylsulfonyl-3H-1,3-benzoxazole-2-thione (CAS 155559-80-1) is a chemical compound with the molecular formula C9H9NO3S2 and a molecular weight of 243.3 g/mol. IUPAC name: 5-ethylsulfonyl-3H-1,3-benzoxazole-2-thione. InChIKey: NGYFZFOTGFAZBR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S2 |
|---|---|
| Molecular weight | 243.3 g/mol |
| IUPAC name | 5-ethylsulfonyl-3H-1,3-benzoxazole-2-thione |
| InChIKey | NGYFZFOTGFAZBR-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC2=C(C=C1)OC(=S)N2 |
Computed by PubChem (NCBI)