Products 1555623-55-6

CAS 1555623-55-6 appears in our catalog under these names: 2-Chlorooxazole-5-carboxylic acid 97%, 2-Chlorooxazole-5-carboxylic acid, 97%, 97%, 2-CHLOROOXAZOLE-5-CARBOXYLIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-chloro-1,3-oxazole-5-carboxylic acid (CAS 1555623-55-6) is a chemical compound with the molecular formula C4H2ClNO3 and a molecular weight of 147.51 g/mol. IUPAC name: 2-chloro-1,3-oxazole-5-carboxylic acid. InChIKey: YPVRRKXUYHUYGA-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2ClNO3
Molecular weight147.51 g/mol
IUPAC name2-chloro-1,3-oxazole-5-carboxylic acid
InChIKeyYPVRRKXUYHUYGA-UHFFFAOYSA-N
SMILESC1=C(OC(=N1)Cl)C(=O)O

Computed by PubChem (NCBI)