CAS 155566-54-4 is the registry number for 1,2,3,4-Tetrahydronaphthalene-1-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
(1S)-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (CAS 155566-54-4) is a chemical compound with the molecular formula C11H12O and a molecular weight of 160.21 g/mol. IUPAC name: (1S)-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde. InChIKey: ZXDOJLXKYNWBMK-SNVBAGLBSA-N.
| Molecular formula | C11H12O |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | (1S)-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| InChIKey | ZXDOJLXKYNWBMK-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](C2=CC=CC=C2C1)C=O |
Computed by PubChem (NCBI)