Products 1555757-16-8

CAS 1555757-16-8 is the registry number for 2-Bromo-5-fluoro-3,6-dimethylterephthalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 50mg, 250mg.

Structural formula: {0} (CAS {1})

2-bromo-5-fluoro-3,6-dimethylterephthalic acid (CAS 1555757-16-8) is a chemical compound with the molecular formula C10H8BrFO4 and a molecular weight of 291.07 g/mol. IUPAC name: 2-bromo-5-fluoro-3,6-dimethylterephthalic acid. InChIKey: XFCOWGKHOZPULW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrFO4
Molecular weight291.07 g/mol
IUPAC name2-bromo-5-fluoro-3,6-dimethylterephthalic acid
InChIKeyXFCOWGKHOZPULW-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1F)C(=O)O)C)Br)C(=O)O

Computed by PubChem (NCBI)