CAS 1555757-16-8 is the registry number for 2-Bromo-5-fluoro-3,6-dimethylterephthalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 50mg, 250mg.
2-bromo-5-fluoro-3,6-dimethylterephthalic acid (CAS 1555757-16-8) is a chemical compound with the molecular formula C10H8BrFO4 and a molecular weight of 291.07 g/mol. IUPAC name: 2-bromo-5-fluoro-3,6-dimethylterephthalic acid. InChIKey: XFCOWGKHOZPULW-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO4 |
|---|---|
| Molecular weight | 291.07 g/mol |
| IUPAC name | 2-bromo-5-fluoro-3,6-dimethylterephthalic acid |
| InChIKey | XFCOWGKHOZPULW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)C(=O)O)C)Br)C(=O)O |
Computed by PubChem (NCBI)