CAS 1556020-32-6 is the registry number for 1,2,5-Tri-O-acetyl-3-deoxy-3-fluoro-D-ribofuranose. Offered by: Biosynth. Available pack sizes: 2g, 1g.
[(2R,3R,4S)-4,5-diacetyloxy-3-fluorooxolan-2-yl]methyl acetate (CAS 1556020-32-6) is a chemical compound with the molecular formula C11H15FO7 and a molecular weight of 278.23 g/mol. IUPAC name: [(2R,3R,4S)-4,5-diacetyloxy-3-fluorooxolan-2-yl]methyl acetate. InChIKey: GHMQCQNHDDLESD-QHPFDFDXSA-N.
| Molecular formula | C11H15FO7 |
|---|---|
| Molecular weight | 278.23 g/mol |
| IUPAC name | [(2R,3R,4S)-4,5-diacetyloxy-3-fluorooxolan-2-yl]methyl acetate |
| InChIKey | GHMQCQNHDDLESD-QHPFDFDXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H](C(O1)OC(=O)C)OC(=O)C)F |
Computed by PubChem (NCBI)