CAS 155614-08-7 appears in our catalog under these names: 4-Methyl-2-phenylchromenylium tetrafluoroborate, 97%, 4-Methyl-2-phenylchromenylium (tetrafluoroborate). Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-methyl-2-phenylchromenylium tetrafluoroborate (CAS 155614-08-7) is a chemical compound with the molecular formula C16H13BF4O and a molecular weight of 308.1 g/mol. IUPAC name: 4-methyl-2-phenylchromenylium tetrafluoroborate. InChIKey: KGDYDKIUTZTTII-UHFFFAOYSA-N.
| Molecular formula | C16H13BF4O |
|---|---|
| Molecular weight | 308.1 g/mol |
| IUPAC name | 4-methyl-2-phenylchromenylium tetrafluoroborate |
| InChIKey | KGDYDKIUTZTTII-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=[O+]C2=CC=CC=C12)C3=CC=CC=C3 |
Computed by PubChem (NCBI)