CAS 155630-26-5 is the registry number for 6-Bromo-5-chloro-5,6,6-trifluoro-2-hexanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-bromo-5-chloro-5,6,6-trifluorohexan-2-one (CAS 155630-26-5) is a chemical compound with the molecular formula C6H7BrClF3O and a molecular weight of 267.47 g/mol. IUPAC name: 6-bromo-5-chloro-5,6,6-trifluorohexan-2-one. InChIKey: IPNZTHFBEOLUHV-UHFFFAOYSA-N.
| Molecular formula | C6H7BrClF3O |
|---|---|
| Molecular weight | 267.47 g/mol |
| IUPAC name | 6-bromo-5-chloro-5,6,6-trifluorohexan-2-one |
| InChIKey | IPNZTHFBEOLUHV-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(C(F)(F)Br)(F)Cl |
Computed by PubChem (NCBI)