CAS 1556536-59-4 is the registry number for N-([3-Fluoro-5-(trifluoromethyl)phenyl]methyl)cyclobutanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]cyclobutanamine (CAS 1556536-59-4) is a chemical compound with the molecular formula C12H13F4N and a molecular weight of 247.23 g/mol. IUPAC name: N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]cyclobutanamine. InChIKey: ZBLGDOCRGFJGPK-UHFFFAOYSA-N.
| Molecular formula | C12H13F4N |
|---|---|
| Molecular weight | 247.23 g/mol |
| IUPAC name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]cyclobutanamine |
| InChIKey | ZBLGDOCRGFJGPK-UHFFFAOYSA-N |
| SMILES | C1CC(C1)NCC2=CC(=CC(=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)