CAS 15568-46-4 is the registry number for 5-Nitropyrimidin-4-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitropyrimidin-4-amine (CAS 15568-46-4) is a chemical compound with the molecular formula C4H4N4O2 and a molecular weight of 140.10 g/mol. IUPAC name: 5-nitropyrimidin-4-amine. InChIKey: IUPXWOAZKBCBLN-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O2 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 5-nitropyrimidin-4-amine |
| InChIKey | IUPXWOAZKBCBLN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC=N1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)