CAS 155681-48-4 appears in our catalog under these names: Maropitant Impurity 6, (2S,3S)-2-Benzhydryl-N-benzylquinuclidin-3-amine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S,3S)-2-benzhydryl-N-benzyl-1-azabicyclo[2.2.2]octan-3-amine (CAS 155681-48-4) is a chemical compound with the molecular formula C27H30N2 and a molecular weight of 382.5 g/mol. IUPAC name: (2S,3S)-2-benzhydryl-N-benzyl-1-azabicyclo[2.2.2]octan-3-amine. InChIKey: SVHVLAGNGAWUQU-SVBPBHIXSA-N.
| Molecular formula | C27H30N2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | (2S,3S)-2-benzhydryl-N-benzyl-1-azabicyclo[2.2.2]octan-3-amine |
| InChIKey | SVHVLAGNGAWUQU-SVBPBHIXSA-N |
| SMILES | C1CN2CCC1[C@@H]([C@@H]2C(C3=CC=CC=C3)C4=CC=CC=C4)NCC5=CC=CC=C5 |
Computed by PubChem (NCBI)